C19H18N6OS — CID 135495899
1-[(5-oxospiro[1,2,4-triazinane-6,9'-fluorene]-3-ylidene)amino]-3-prop-2-enylthiourea (PubChem CID 135495899) has the molecular formula C19H18N6OS and a molecular weight of 378.46 g/mol. Its IUPAC name is 1-[(5-oxospiro[1,2,4-triazinane-6,9'-fluorene]-3-ylidene)amino]-3-prop-2-enylthiourea.
| Compound Name | 1-[(5-oxospiro[1,2,4-triazinane-6,9'-fluorene]-3-ylidene)amino]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 135495899 |
| Molecular Formula | C19H18N6OS |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 1-[(5-oxospiro[1,2,4-triazinane-6,9'-fluorene]-3-ylidene)amino]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)NN=C1NNC2(C(=O)N1)c1ccccc1-c1ccccc12 |
| InChI | InChI=1S/C19H18N6OS/c1-2-11-20-18(27)24-22-17-21-16(26)19(25-23-17)14-9-5-3-7-12(14)13-8-4-6-10-15(13)19/h2-10,25H,1,11H2,(H2,20,24,27)(H2,21,22,23,26) |
| InChIKey | MOMQBYSWHJIXCL-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 89.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|