C28H19N5O — CID 137269443
(3Z)-3-(fluoren-9-ylidenehydrazinylidene)spiro[1,2,4-triazinane-6,9'-fluorene]-5-one (PubChem CID 137269443) has the molecular formula C28H19N5O and a molecular weight of 441.49 g/mol. Its IUPAC name is (3Z)-3-(fluoren-9-ylidenehydrazinylidene)spiro[1,2,4-triazinane-6,9'-fluorene]-5-one.
| Compound Name | (3Z)-3-(fluoren-9-ylidenehydrazinylidene)spiro[1,2,4-triazinane-6,9'-fluorene]-5-one |
|---|---|
| PubChem CID | 137269443 |
| Molecular Formula | C28H19N5O |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | (3Z)-3-(fluoren-9-ylidenehydrazinylidene)spiro[1,2,4-triazinane-6,9'-fluorene]-5-one |
| SMILES | O=C1N/C(=N/N=C2c3ccccc3-c3ccccc32)NNC12c1ccccc1-c1ccccc12 |
| InChI | InChI=1S/C28H19N5O/c34-26-28(23-15-7-5-11-19(23)20-12-6-8-16-24(20)28)33-32-27(29-26)31-30-25-21-13-3-1-9-17(21)18-10-2-4-14-22(18)25/h1-16,33H,(H2,29,31,32,34) |
| InChIKey | NSGPWWFTXHJRMD-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|