C16H13N7O — CID 135496374
3-hydrazinylspiro[5,8-dihydro-[1,2,4]triazolo[4,3-b][1,2,4]triazine-6,9'-fluorene]-7-one (PubChem CID 135496374) has the molecular formula C16H13N7O and a molecular weight of 319.33 g/mol. Its IUPAC name is 3-hydrazinylspiro[5,8-dihydro-[1,2,4]triazolo[4,3-b][1,2,4]triazine-6,9'-fluorene]-7-one.
| Compound Name | 3-hydrazinylspiro[5,8-dihydro-[1,2,4]triazolo[4,3-b][1,2,4]triazine-6,9'-fluorene]-7-one |
|---|---|
| PubChem CID | 135496374 |
| Molecular Formula | C16H13N7O |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 3-hydrazinylspiro[5,8-dihydro-[1,2,4]triazolo[4,3-b][1,2,4]triazine-6,9'-fluorene]-7-one |
| SMILES | NNc1nnc2n1NC1(C(=O)N2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C16H13N7O/c17-19-15-21-20-14-18-13(24)16(22-23(14)15)11-7-3-1-5-9(11)10-6-2-4-8-12(10)16/h1-8,22H,17H2,(H,19,21)(H,18,20,24) |
| InChIKey | UFRIKGRSJOVWSH-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 109.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|