C30H20N6O2S2 — CID 135409126
3-[(5-oxospiro[1,4-dihydro-1,2,4-triazine-6,9'-fluorene]-3-yl)disulfanyl]spiro[1,4-dihydro-1,2,4-triazine-6,9'-fluorene]-5-one (PubChem CID 135409126) has the molecular formula C30H20N6O2S2 and a molecular weight of 560.66 g/mol. Its IUPAC name is 3-[(5-oxospiro[1,4-dihydro-1,2,4-triazine-6,9'-fluorene]-3-yl)disulfanyl]spiro[1,4-dihydro-1,2,4-triazine-6,9'-fluorene]-5-one.
| Compound Name | 3-[(5-oxospiro[1,4-dihydro-1,2,4-triazine-6,9'-fluorene]-3-yl)disulfanyl]spiro[1,4-dihydro-1,2,4-triazine-6,9'-fluorene]-5-one |
|---|---|
| PubChem CID | 135409126 |
| Molecular Formula | C30H20N6O2S2 |
| Molecular Weight | 560.66 g/mol |
| Exact Mass | 560.11 |
| IUPAC Name | 3-[(5-oxospiro[1,4-dihydro-1,2,4-triazine-6,9'-fluorene]-3-yl)disulfanyl]spiro[1,4-dihydro-1,2,4-triazine-6,9'-fluorene]-5-one |
| SMILES | O=C1NC(SSC2=NNC3(C(=O)N2)c2ccccc2-c2ccccc23)=NNC12c1ccccc1-c1ccccc12 |
| InChI | InChI=1S/C30H20N6O2S2/c37-25-29(21-13-5-1-9-17(21)18-10-2-6-14-22(18)29)35-33-27(31-25)39-40-28-32-26(38)30(36-34-28)23-15-7-3-11-19(23)20-12-4-8-16-24(20)30/h1-16,35-36H,(H,31,33,37)(H,32,34,38) |
| InChIKey | YPHGNFUZJXVGOR-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.66 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|