C24H14ClN3O2S — CID 10433543
(2E)-2-[(4-chlorophenyl)methylidene]spiro[5H-[1,3]thiazolo[3,2-b][1,2,4]triazine-6,9'-fluorene]-3,7-dione (PubChem CID 10433543) has the molecular formula C24H14ClN3O2S and a molecular weight of 443.92 g/mol. Its IUPAC name is (2E)-2-[(4-chlorophenyl)methylidene]spiro[5H-[1,3]thiazolo[3,2-b][1,2,4]triazine-6,9'-fluorene]-3,7-dione.
| Compound Name | (2E)-2-[(4-chlorophenyl)methylidene]spiro[5H-[1,3]thiazolo[3,2-b][1,2,4]triazine-6,9'-fluorene]-3,7-dione |
|---|---|
| PubChem CID | 10433543 |
| Molecular Formula | C24H14ClN3O2S |
| Molecular Weight | 443.92 g/mol |
| Exact Mass | 443.05 |
| IUPAC Name | (2E)-2-[(4-chlorophenyl)methylidene]spiro[5H-[1,3]thiazolo[3,2-b][1,2,4]triazine-6,9'-fluorene]-3,7-dione |
| SMILES | O=C1N=c2s/c(=C/c3ccc(Cl)cc3)c(=O)n2NC12c1ccccc1-c1ccccc12 |
| InChI | InChI=1S/C24H14ClN3O2S/c25-15-11-9-14(10-12-15)13-20-21(29)28-23(31-20)26-22(30)24(27-28)18-7-3-1-5-16(18)17-6-2-4-8-19(17)24/h1-13,27H/b20-13+ |
| InChIKey | HMLJFEULQXCDJL-DEDYPNTBSA-N |
| XLogP | 3.02 |
| TPSA | 63.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.92 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |