C26H21N3O6S — CID 11306657
(E)-N-[4-(benzylsulfamoyl)phenyl]-3-[5-(4-nitrophenyl)furan-2-yl]prop-2-enamide (PubChem CID 11306657) has the molecular formula C26H21N3O6S and a molecular weight of 503.54 g/mol. Its IUPAC name is (E)-N-[4-(benzylsulfamoyl)phenyl]-3-[5-(4-nitrophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[4-(benzylsulfamoyl)phenyl]-3-[5-(4-nitrophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 11306657 |
| Molecular Formula | C26H21N3O6S |
| Molecular Weight | 503.54 g/mol |
| Exact Mass | 503.12 |
| IUPAC Name | (E)-N-[4-(benzylsulfamoyl)phenyl]-3-[5-(4-nitrophenyl)furan-2-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2ccc([N+](=O)[O-])cc2)o1)Nc1ccc(S(=O)(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H21N3O6S/c30-26(17-13-23-12-16-25(35-23)20-6-10-22(11-7-20)29(31)32)28-21-8-14-24(15-9-21)36(33,34)27-18-19-4-2-1-3-5-19/h1-17,27H,18H2,(H,28,30)/b17-13+ |
| InChIKey | FZZNEWGEHBHCRE-GHRIWEEISA-N |
| XLogP | 4.99 |
| TPSA | 131.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.54 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|