C34H24BrN3O6 — CID 10211664
(E)-N-[3-benzoyl-4-[[2-(4-bromophenyl)acetyl]amino]phenyl]-3-[5-(4-nitrophenyl)furan-2-yl]prop-2-enamide (PubChem CID 10211664) has the molecular formula C34H24BrN3O6 and a molecular weight of 650.49 g/mol. Its IUPAC name is (E)-N-[3-benzoyl-4-[[2-(4-bromophenyl)acetyl]amino]phenyl]-3-[5-(4-nitrophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[3-benzoyl-4-[[2-(4-bromophenyl)acetyl]amino]phenyl]-3-[5-(4-nitrophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 10211664 |
| Molecular Formula | C34H24BrN3O6 |
| Molecular Weight | 650.49 g/mol |
| Exact Mass | 649.08 |
| IUPAC Name | (E)-N-[3-benzoyl-4-[[2-(4-bromophenyl)acetyl]amino]phenyl]-3-[5-(4-nitrophenyl)furan-2-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2ccc([N+](=O)[O-])cc2)o1)Nc1ccc(NC(=O)Cc2ccc(Br)cc2)c(C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C34H24BrN3O6/c35-25-10-6-22(7-11-25)20-33(40)37-30-17-12-26(21-29(30)34(41)24-4-2-1-3-5-24)36-32(39)19-16-28-15-18-31(44-28)23-8-13-27(14-9-23)38(42)43/h1-19,21H,20H2,(H,36,39)(H,37,40)/b19-16+ |
| InChIKey | UMSPOZHZJOSWJD-KNTRCKAVSA-N |
| XLogP | 7.68 |
| TPSA | 131.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.49 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|