C21H28N2O4S — CID 43906879
(E)-3-[5-[[methyl(methylsulfonyl)amino]methyl]furan-2-yl]-N-[1-(2,4,5-trimethylphenyl)ethyl]prop-2-enamide (PubChem CID 43906879) has the molecular formula C21H28N2O4S and a molecular weight of 404.53 g/mol. Its IUPAC name is (E)-3-[5-[[methyl(methylsulfonyl)amino]methyl]furan-2-yl]-N-[1-(2,4,5-trimethylphenyl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-[5-[[methyl(methylsulfonyl)amino]methyl]furan-2-yl]-N-[1-(2,4,5-trimethylphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 43906879 |
| Molecular Formula | C21H28N2O4S |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | (E)-3-[5-[[methyl(methylsulfonyl)amino]methyl]furan-2-yl]-N-[1-(2,4,5-trimethylphenyl)ethyl]prop-2-enamide |
| SMILES | Cc1cc(C)c(C(C)NC(=O)/C=C/c2ccc(CN(C)S(C)(=O)=O)o2)cc1C |
| InChI | InChI=1S/C21H28N2O4S/c1-14-11-16(3)20(12-15(14)2)17(4)22-21(24)10-9-18-7-8-19(27-18)13-23(5)28(6,25)26/h7-12,17H,13H2,1-6H3,(H,22,24)/b10-9+ |
| InChIKey | QYEUAPDWNGYGMM-MDZDMXLPSA-N |
| XLogP | 3.49 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|