C22H23N3O3S2 — CID 43075967
1-[2-(4-methoxyphenyl)ethyl]-3-[3-(phenylsulfamoyl)phenyl]thiourea (PubChem CID 43075967) has the molecular formula C22H23N3O3S2 and a molecular weight of 441.58 g/mol. Its IUPAC name is 1-[2-(4-methoxyphenyl)ethyl]-3-[3-(phenylsulfamoyl)phenyl]thiourea.
| Compound Name | 1-[2-(4-methoxyphenyl)ethyl]-3-[3-(phenylsulfamoyl)phenyl]thiourea |
|---|---|
| PubChem CID | 43075967 |
| Molecular Formula | C22H23N3O3S2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | 1-[2-(4-methoxyphenyl)ethyl]-3-[3-(phenylsulfamoyl)phenyl]thiourea |
| SMILES | COc1ccc(CCNC(=S)Nc2cccc(S(=O)(=O)Nc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C22H23N3O3S2/c1-28-20-12-10-17(11-13-20)14-15-23-22(29)24-19-8-5-9-21(16-19)30(26,27)25-18-6-3-2-4-7-18/h2-13,16,25H,14-15H2,1H3,(H2,23,24,29) |
| InChIKey | YUMYOPCVGYVIAE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|