C18H18F4N2O2 — CID 60588883
1-[4-ethoxy-2-(trifluoromethyl)phenyl]-3-[2-(4-fluorophenyl)ethyl]urea (PubChem CID 60588883) has the molecular formula C18H18F4N2O2 and a molecular weight of 370.35 g/mol. Its IUPAC name is 1-[4-ethoxy-2-(trifluoromethyl)phenyl]-3-[2-(4-fluorophenyl)ethyl]urea.
| Compound Name | 1-[4-ethoxy-2-(trifluoromethyl)phenyl]-3-[2-(4-fluorophenyl)ethyl]urea |
|---|---|
| PubChem CID | 60588883 |
| Molecular Formula | C18H18F4N2O2 |
| Molecular Weight | 370.35 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 1-[4-ethoxy-2-(trifluoromethyl)phenyl]-3-[2-(4-fluorophenyl)ethyl]urea |
| SMILES | CCOc1ccc(NC(=O)NCCc2ccc(F)cc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H18F4N2O2/c1-2-26-14-7-8-16(15(11-14)18(20,21)22)24-17(25)23-10-9-12-3-5-13(19)6-4-12/h3-8,11H,2,9-10H2,1H3,(H2,23,24,25) |
| InChIKey | NXYTYIPKLNZWNE-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.35 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |