C19H18F4N2O3 — CID 86812675
N'-(2-ethoxy-4-fluorophenyl)-N-[2-[4-(trifluoromethyl)phenyl]ethyl]oxamide (PubChem CID 86812675) has the molecular formula C19H18F4N2O3 and a molecular weight of 398.36 g/mol. Its IUPAC name is N'-(2-ethoxy-4-fluorophenyl)-N-[2-[4-(trifluoromethyl)phenyl]ethyl]oxamide.
| Compound Name | N'-(2-ethoxy-4-fluorophenyl)-N-[2-[4-(trifluoromethyl)phenyl]ethyl]oxamide |
|---|---|
| PubChem CID | 86812675 |
| Molecular Formula | C19H18F4N2O3 |
| Molecular Weight | 398.36 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | N'-(2-ethoxy-4-fluorophenyl)-N-[2-[4-(trifluoromethyl)phenyl]ethyl]oxamide |
| SMILES | CCOc1cc(F)ccc1NC(=O)C(=O)NCCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H18F4N2O3/c1-2-28-16-11-14(20)7-8-15(16)25-18(27)17(26)24-10-9-12-3-5-13(6-4-12)19(21,22)23/h3-8,11H,2,9-10H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | XGXUIQULEOCEHJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.36 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|