C17H16FN3O6 — CID 121085621
N-[2-cyclopropyl-2-(furan-2-yl)-2-hydroxyethyl]-N'-(4-fluoro-3-nitrophenyl)oxamide (PubChem CID 121085621) has the molecular formula C17H16FN3O6 and a molecular weight of 377.33 g/mol. Its IUPAC name is N-[2-cyclopropyl-2-(furan-2-yl)-2-hydroxyethyl]-N'-(4-fluoro-3-nitrophenyl)oxamide.
| Compound Name | N-[2-cyclopropyl-2-(furan-2-yl)-2-hydroxyethyl]-N'-(4-fluoro-3-nitrophenyl)oxamide |
|---|---|
| PubChem CID | 121085621 |
| Molecular Formula | C17H16FN3O6 |
| Molecular Weight | 377.33 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | N-[2-cyclopropyl-2-(furan-2-yl)-2-hydroxyethyl]-N'-(4-fluoro-3-nitrophenyl)oxamide |
| SMILES | O=C(NCC(O)(c1ccco1)C1CC1)C(=O)Nc1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H16FN3O6/c18-12-6-5-11(8-13(12)21(25)26)20-16(23)15(22)19-9-17(24,10-3-4-10)14-2-1-7-27-14/h1-2,5-8,10,24H,3-4,9H2,(H,19,22)(H,20,23) |
| InChIKey | DTYYPIREAALPSV-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 134.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.33 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|