C13H19N3O3 — CID 16875563
N'-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-N-prop-2-enyloxamide (PubChem CID 16875563) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is N'-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-N-prop-2-enyloxamide.
| Compound Name | N'-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-N-prop-2-enyloxamide |
|---|---|
| PubChem CID | 16875563 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | N'-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-N-prop-2-enyloxamide |
| SMILES | C=CCNC(=O)C(=O)NCC(c1ccco1)N(C)C |
| InChI | InChI=1S/C13H19N3O3/c1-4-7-14-12(17)13(18)15-9-10(16(2)3)11-6-5-8-19-11/h4-6,8,10H,1,7,9H2,2-3H3,(H,14,17)(H,15,18) |
| InChIKey | LYGPVNDMSNDYSZ-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|