C23H19N3O3 — CID 56990515
1-[(1R)-1-naphthalen-1-ylethyl]-3-(8-nitronaphthalen-2-yl)urea (PubChem CID 56990515) has the molecular formula C23H19N3O3 and a molecular weight of 385.42 g/mol. Its IUPAC name is 1-[(1R)-1-naphthalen-1-ylethyl]-3-(8-nitronaphthalen-2-yl)urea.
| Compound Name | 1-[(1R)-1-naphthalen-1-ylethyl]-3-(8-nitronaphthalen-2-yl)urea |
|---|---|
| PubChem CID | 56990515 |
| Molecular Formula | C23H19N3O3 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 1-[(1R)-1-naphthalen-1-ylethyl]-3-(8-nitronaphthalen-2-yl)urea |
| SMILES | C[C@@H](NC(=O)Nc1ccc2cccc([N+](=O)[O-])c2c1)c1cccc2ccccc12 |
| InChI | InChI=1S/C23H19N3O3/c1-15(19-10-4-7-16-6-2-3-9-20(16)19)24-23(27)25-18-13-12-17-8-5-11-22(26(28)29)21(17)14-18/h2-15H,1H3,(H2,24,25,27)/t15-/m1/s1 |
| InChIKey | CFEGGKKKVFXJQQ-OAHLLOKOSA-N |
| XLogP | 5.78 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|