C24H23N3O3 — CID 99807610
1-[4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl]-3-[(1S)-1-naphthalen-1-ylethyl]urea (PubChem CID 99807610) has the molecular formula C24H23N3O3 and a molecular weight of 401.47 g/mol. Its IUPAC name is 1-[4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl]-3-[(1S)-1-naphthalen-1-ylethyl]urea.
| Compound Name | 1-[4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl]-3-[(1S)-1-naphthalen-1-ylethyl]urea |
|---|---|
| PubChem CID | 99807610 |
| Molecular Formula | C24H23N3O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 1-[4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl]-3-[(1S)-1-naphthalen-1-ylethyl]urea |
| SMILES | Cc1cc(NC(=O)N[C@@H](C)c2cccc3ccccc23)ccc1N1C(=O)CCC1=O |
| InChI | InChI=1S/C24H23N3O3/c1-15-14-18(10-11-21(15)27-22(28)12-13-23(27)29)26-24(30)25-16(2)19-9-5-7-17-6-3-4-8-20(17)19/h3-11,14,16H,12-13H2,1-2H3,(H2,25,26,30)/t16-/m0/s1 |
| InChIKey | RHABYYXJJLJRPJ-INIZCTEOSA-N |
| XLogP | 4.68 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|