C27H23N3O3 — CID 70395287
1-[(1R)-1-naphthalen-1-ylethyl]-3-(7-nitro-9,10-dihydrophenanthren-2-yl)urea (PubChem CID 70395287) has the molecular formula C27H23N3O3 and a molecular weight of 437.50 g/mol. Its IUPAC name is 1-[(1R)-1-naphthalen-1-ylethyl]-3-(7-nitro-9,10-dihydrophenanthren-2-yl)urea.
| Compound Name | 1-[(1R)-1-naphthalen-1-ylethyl]-3-(7-nitro-9,10-dihydrophenanthren-2-yl)urea |
|---|---|
| PubChem CID | 70395287 |
| Molecular Formula | C27H23N3O3 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 1-[(1R)-1-naphthalen-1-ylethyl]-3-(7-nitro-9,10-dihydrophenanthren-2-yl)urea |
| SMILES | C[C@@H](NC(=O)Nc1ccc2c(c1)CCc1cc([N+](=O)[O-])ccc1-2)c1cccc2ccccc12 |
| InChI | InChI=1S/C27H23N3O3/c1-17(23-8-4-6-18-5-2-3-7-24(18)23)28-27(31)29-21-11-13-25-19(15-21)9-10-20-16-22(30(32)33)12-14-26(20)25/h2-8,11-17H,9-10H2,1H3,(H2,28,29,31)/t17-/m1/s1 |
| InChIKey | TUWQLWUNCYYSNI-QGZVFWFLSA-N |
| XLogP | 6.40 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|