C22H25N3O2 — CID 108511092
N'-[1-(4-ethylphenyl)ethyl]-N-[2-(1H-indol-3-yl)ethyl]oxamide (PubChem CID 108511092) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is N'-[1-(4-ethylphenyl)ethyl]-N-[2-(1H-indol-3-yl)ethyl]oxamide.
| Compound Name | N'-[1-(4-ethylphenyl)ethyl]-N-[2-(1H-indol-3-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 108511092 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | N'-[1-(4-ethylphenyl)ethyl]-N-[2-(1H-indol-3-yl)ethyl]oxamide |
| SMILES | CCc1ccc(C(C)NC(=O)C(=O)NCCc2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C22H25N3O2/c1-3-16-8-10-17(11-9-16)15(2)25-22(27)21(26)23-13-12-18-14-24-20-7-5-4-6-19(18)20/h4-11,14-15,24H,3,12-13H2,1-2H3,(H,23,26)(H,25,27) |
| InChIKey | PXNBMBOKCXGXQZ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|