C13H16F3N3O2 — CID 82097400
4-(aminomethyl)-N-[3-[(2,2,2-trifluoroacetyl)amino]propyl]benzamide (PubChem CID 82097400) has the molecular formula C13H16F3N3O2 and a molecular weight of 303.28 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[3-[(2,2,2-trifluoroacetyl)amino]propyl]benzamide.
| Compound Name | 4-(aminomethyl)-N-[3-[(2,2,2-trifluoroacetyl)amino]propyl]benzamide |
|---|---|
| PubChem CID | 82097400 |
| Molecular Formula | C13H16F3N3O2 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 4-(aminomethyl)-N-[3-[(2,2,2-trifluoroacetyl)amino]propyl]benzamide |
| SMILES | NCc1ccc(C(=O)NCCCNC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H16F3N3O2/c14-13(15,16)12(21)19-7-1-6-18-11(20)10-4-2-9(8-17)3-5-10/h2-5H,1,6-8,17H2,(H,18,20)(H,19,21) |
| InChIKey | IUMNYVIKWSEEQP-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|