C31H31NO4 — CID 564164
2-[3,5-bis(phenylmethoxy)phenyl]-N-[2-(3-methoxyphenyl)ethyl]acetamide (PubChem CID 564164) has the molecular formula C31H31NO4 and a molecular weight of 481.59 g/mol. Its IUPAC name is 2-[3,5-bis(phenylmethoxy)phenyl]-N-[2-(3-methoxyphenyl)ethyl]acetamide.
| Compound Name | 2-[3,5-bis(phenylmethoxy)phenyl]-N-[2-(3-methoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 564164 |
| Molecular Formula | C31H31NO4 |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | 2-[3,5-bis(phenylmethoxy)phenyl]-N-[2-(3-methoxyphenyl)ethyl]acetamide |
| SMILES | COc1cccc(CCNC(=O)Cc2cc(OCc3ccccc3)cc(OCc3ccccc3)c2)c1 |
| InChI | InChI=1S/C31H31NO4/c1-34-28-14-8-13-24(17-28)15-16-32-31(33)20-27-18-29(35-22-25-9-4-2-5-10-25)21-30(19-27)36-23-26-11-6-3-7-12-26/h2-14,17-19,21H,15-16,20,22-23H2,1H3,(H,32,33) |
| InChIKey | IGSKNFHPTPNEGL-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |