C33H38N2O3 — CID 159272620
2-(3-phenylmethoxyphenyl)ethanamine;N-[2-(3-phenylmethoxyphenyl)ethyl]propanamide (PubChem CID 159272620) has the molecular formula C33H38N2O3 and a molecular weight of 510.68 g/mol. Its IUPAC name is 2-(3-phenylmethoxyphenyl)ethanamine;N-[2-(3-phenylmethoxyphenyl)ethyl]propanamide.
| Compound Name | 2-(3-phenylmethoxyphenyl)ethanamine;N-[2-(3-phenylmethoxyphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 159272620 |
| Molecular Formula | C33H38N2O3 |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.29 |
| IUPAC Name | 2-(3-phenylmethoxyphenyl)ethanamine;N-[2-(3-phenylmethoxyphenyl)ethyl]propanamide |
| SMILES | CCC(=O)NCCc1cccc(OCc2ccccc2)c1.NCCc1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C18H21NO2.C15H17NO/c1-2-18(20)19-12-11-15-9-6-10-17(13-15)21-14-16-7-4-3-5-8-16;16-10-9-13-7-4-8-15(11-13)17-12-14-5-2-1-3-6-14/h3-10,13H,2,11-12,14H2,1H3,(H,19,20);1-8,11H,9-10,12,16H2 |
| InChIKey | KXXBGEYFQASVGH-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |