C31H31NO4 — CID 44563474
2,2,2-tris(4-methoxyphenyl)-N-(2-phenylethyl)acetamide (PubChem CID 44563474) has the molecular formula C31H31NO4 and a molecular weight of 481.59 g/mol. Its IUPAC name is 2,2,2-tris(4-methoxyphenyl)-N-(2-phenylethyl)acetamide.
| Compound Name | 2,2,2-tris(4-methoxyphenyl)-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 44563474 |
| Molecular Formula | C31H31NO4 |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | 2,2,2-tris(4-methoxyphenyl)-N-(2-phenylethyl)acetamide |
| SMILES | COc1ccc(C(C(=O)NCCc2ccccc2)(c2ccc(OC)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C31H31NO4/c1-34-27-15-9-24(10-16-27)31(25-11-17-28(35-2)18-12-25,26-13-19-29(36-3)20-14-26)30(33)32-22-21-23-7-5-4-6-8-23/h4-20H,21-22H2,1-3H3,(H,32,33) |
| InChIKey | IAUXMONHDHOAEN-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|