C13H18N2O2S — CID 115131167
2-[(2,5-dimethoxy-4-methylsulfanylphenyl)methyl-methylamino]acetonitrile (PubChem CID 115131167) has the molecular formula C13H18N2O2S and a molecular weight of 266.37 g/mol. Its IUPAC name is 2-[(2,5-dimethoxy-4-methylsulfanylphenyl)methyl-methylamino]acetonitrile.
| Compound Name | 2-[(2,5-dimethoxy-4-methylsulfanylphenyl)methyl-methylamino]acetonitrile |
|---|---|
| PubChem CID | 115131167 |
| Molecular Formula | C13H18N2O2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 2-[(2,5-dimethoxy-4-methylsulfanylphenyl)methyl-methylamino]acetonitrile |
| SMILES | COc1cc(SC)c(OC)cc1CN(C)CC#N |
| InChI | InChI=1S/C13H18N2O2S/c1-15(6-5-14)9-10-7-12(17-3)13(18-4)8-11(10)16-2/h7-8H,6,9H2,1-4H3 |
| InChIKey | VXNMNICKNNMPNE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|