C12H15FN2O — CID 115230942
3-[(5-fluoro-2-methoxyphenyl)methyl-methylamino]propanenitrile (PubChem CID 115230942) has the molecular formula C12H15FN2O and a molecular weight of 222.26 g/mol. Its IUPAC name is 3-[(5-fluoro-2-methoxyphenyl)methyl-methylamino]propanenitrile.
| Compound Name | 3-[(5-fluoro-2-methoxyphenyl)methyl-methylamino]propanenitrile |
|---|---|
| PubChem CID | 115230942 |
| Molecular Formula | C12H15FN2O |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 3-[(5-fluoro-2-methoxyphenyl)methyl-methylamino]propanenitrile |
| SMILES | COc1ccc(F)cc1CN(C)CCC#N |
| InChI | InChI=1S/C12H15FN2O/c1-15(7-3-6-14)9-10-8-11(13)4-5-12(10)16-2/h4-5,8H,3,7,9H2,1-2H3 |
| InChIKey | MRWVHZJFHBSDSP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |