C11H13FN2O — CID 115131065
2-[(5-fluoro-2-methoxyphenyl)methyl-methylamino]acetonitrile (PubChem CID 115131065) has the molecular formula C11H13FN2O and a molecular weight of 208.24 g/mol. Its IUPAC name is 2-[(5-fluoro-2-methoxyphenyl)methyl-methylamino]acetonitrile.
| Compound Name | 2-[(5-fluoro-2-methoxyphenyl)methyl-methylamino]acetonitrile |
|---|---|
| PubChem CID | 115131065 |
| Molecular Formula | C11H13FN2O |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 2-[(5-fluoro-2-methoxyphenyl)methyl-methylamino]acetonitrile |
| SMILES | COc1ccc(F)cc1CN(C)CC#N |
| InChI | InChI=1S/C11H13FN2O/c1-14(6-5-13)8-9-7-10(12)3-4-11(9)15-2/h3-4,7H,6,8H2,1-2H3 |
| InChIKey | BFVIOGLPZJDUGB-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|