C14H19FN2O — CID 115129680
2-[2-(5-fluoro-2-methoxyphenyl)ethyl-methylamino]-2-methylpropanenitrile (PubChem CID 115129680) has the molecular formula C14H19FN2O and a molecular weight of 250.32 g/mol. Its IUPAC name is 2-[2-(5-fluoro-2-methoxyphenyl)ethyl-methylamino]-2-methylpropanenitrile.
| Compound Name | 2-[2-(5-fluoro-2-methoxyphenyl)ethyl-methylamino]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 115129680 |
| Molecular Formula | C14H19FN2O |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 2-[2-(5-fluoro-2-methoxyphenyl)ethyl-methylamino]-2-methylpropanenitrile |
| SMILES | COc1ccc(F)cc1CCN(C)C(C)(C)C#N |
| InChI | InChI=1S/C14H19FN2O/c1-14(2,10-16)17(3)8-7-11-9-12(15)5-6-13(11)18-4/h5-6,9H,7-8H2,1-4H3 |
| InChIKey | XAPMLWNBMGEHAO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |