C11H14FNO2 — CID 115223032
2-[(5-fluoro-2-methoxyphenyl)methyl-methylamino]acetaldehyde (PubChem CID 115223032) has the molecular formula C11H14FNO2 and a molecular weight of 211.24 g/mol. Its IUPAC name is 2-[(5-fluoro-2-methoxyphenyl)methyl-methylamino]acetaldehyde.
| Compound Name | 2-[(5-fluoro-2-methoxyphenyl)methyl-methylamino]acetaldehyde |
|---|---|
| PubChem CID | 115223032 |
| Molecular Formula | C11H14FNO2 |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 2-[(5-fluoro-2-methoxyphenyl)methyl-methylamino]acetaldehyde |
| SMILES | COc1ccc(F)cc1CN(C)CC=O |
| InChI | InChI=1S/C11H14FNO2/c1-13(5-6-14)8-9-7-10(12)3-4-11(9)15-2/h3-4,6-7H,5,8H2,1-2H3 |
| InChIKey | UWIYABFGXDQXNH-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|