C12H16FNO2 — CID 115223071
2-[(4-ethoxy-3-fluorophenyl)methyl-methylamino]acetaldehyde (PubChem CID 115223071) has the molecular formula C12H16FNO2 and a molecular weight of 225.26 g/mol. Its IUPAC name is 2-[(4-ethoxy-3-fluorophenyl)methyl-methylamino]acetaldehyde.
| Compound Name | 2-[(4-ethoxy-3-fluorophenyl)methyl-methylamino]acetaldehyde |
|---|---|
| PubChem CID | 115223071 |
| Molecular Formula | C12H16FNO2 |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 2-[(4-ethoxy-3-fluorophenyl)methyl-methylamino]acetaldehyde |
| SMILES | CCOc1ccc(CN(C)CC=O)cc1F |
| InChI | InChI=1S/C12H16FNO2/c1-3-16-12-5-4-10(8-11(12)13)9-14(2)6-7-15/h4-5,7-8H,3,6,9H2,1-2H3 |
| InChIKey | VWNKDIGRPDNONA-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|