C10H15N3 — CID 130854740
N-(azetidin-3-ylmethyl)-3-methylpyridin-4-amine (PubChem CID 130854740) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is N-(azetidin-3-ylmethyl)-3-methylpyridin-4-amine.
| Compound Name | N-(azetidin-3-ylmethyl)-3-methylpyridin-4-amine |
|---|---|
| PubChem CID | 130854740 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | N-(azetidin-3-ylmethyl)-3-methylpyridin-4-amine |
| SMILES | Cc1cnccc1NCC1CNC1 |
| InChI | InChI=1S/C10H15N3/c1-8-4-11-3-2-10(8)13-7-9-5-12-6-9/h2-4,9,12H,5-7H2,1H3,(H,11,13) |
| InChIKey | PFZVPJXRWXKWIR-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |