C18H23O2P — CID 175501578
bis(4-methoxy-2,5-dimethylphenyl)phosphane (PubChem CID 175501578) has the molecular formula C18H23O2P and a molecular weight of 302.35 g/mol. Its IUPAC name is bis(4-methoxy-2,5-dimethylphenyl)phosphane.
| Compound Name | bis(4-methoxy-2,5-dimethylphenyl)phosphane |
|---|---|
| PubChem CID | 175501578 |
| Molecular Formula | C18H23O2P |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | bis(4-methoxy-2,5-dimethylphenyl)phosphane |
| SMILES | COc1cc(C)c(Pc2cc(C)c(OC)cc2C)cc1C |
| InChI | InChI=1S/C18H23O2P/c1-11-9-17(13(3)7-15(11)19-5)21-18-10-12(2)16(20-6)8-14(18)4/h7-10,21H,1-6H3 |
| InChIKey | JSPOPRIQBNNSPL-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|