C9H12Br2O — CID 157211395
1-bromo-4-methoxy-2,5-dimethylbenzene;hydrobromide (PubChem CID 157211395) has the molecular formula C9H12Br2O and a molecular weight of 296.00 g/mol. Its IUPAC name is 1-bromo-4-methoxy-2,5-dimethylbenzene;hydrobromide.
| Compound Name | 1-bromo-4-methoxy-2,5-dimethylbenzene;hydrobromide |
|---|---|
| PubChem CID | 157211395 |
| Molecular Formula | C9H12Br2O |
| Molecular Weight | 296.00 g/mol |
| Exact Mass | 293.93 |
| IUPAC Name | 1-bromo-4-methoxy-2,5-dimethylbenzene;hydrobromide |
| SMILES | Br.COc1cc(C)c(Br)cc1C |
| InChI | InChI=1S/C9H11BrO.BrH/c1-6-5-9(11-3)7(2)4-8(6)10;/h4-5H,1-3H3;1H |
| InChIKey | MGCDABJRSLFJIW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.00 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |