About (2-chloro-4,5-dimethylphenyl) N-methylcarbamate;hydrochloride
(2-chloro-4,5-dimethylphenyl) N-methylcarbamate;hydrochloride (PubChem CID 172729732) has the molecular formula C10H13Cl2NO2
and a molecular weight of 250.12 g/mol. Its IUPAC name is (2-chloro-4,5-dimethylphenyl) N-methylcarbamate;hydrochloride.
Analyze (2-chloro-4,5-dimethylphenyl) N-methylcarbamate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-4,5-dimethylphenyl) N-methylcarbamate;hydrochloride?
The IUPAC name of (2-chloro-4,5-dimethylphenyl) N-methylcarbamate;hydrochloride (CID 172729732) is (2-chloro-4,5-dimethylphenyl) N-methylcarbamate;hydrochloride.
What is the SMILES notation for (2-chloro-4,5-dimethylphenyl) N-methylcarbamate;hydrochloride?
The canonical SMILES for (2-chloro-4,5-dimethylphenyl) N-methylcarbamate;hydrochloride is CNC(=O)Oc1cc(C)c(C)cc1Cl.Cl.
What is the InChIKey of (2-chloro-4,5-dimethylphenyl) N-methylcarbamate;hydrochloride?
The InChIKey is HQAMKPDCIUFYGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClNO2.ClH/c1-6-4-8(11)9(5-7(6)2)14-10(13)12-3;/h4-5H,1-3H3,(H,12,13);1H.
What are the key properties of (2-chloro-4,5-dimethylphenyl) N-methylcarbamate;hydrochloride?
(2-chloro-4,5-dimethylphenyl) N-methylcarbamate;hydrochloride has a molecular weight of 250.12 g/mol, XLogP of 3.10, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-4,5-dimethylphenyl) N-methylcarbamate;hydrochloride is sourced from PubChem (CID 172729732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).