C16H18ClNO3 — CID 21114999
(2-chloro-4,5-dimethylphenyl) N-methylcarbamate;phenol (PubChem CID 21114999) has the molecular formula C16H18ClNO3 and a molecular weight of 307.78 g/mol. Its IUPAC name is (2-chloro-4,5-dimethylphenyl) N-methylcarbamate;phenol.
| Compound Name | (2-chloro-4,5-dimethylphenyl) N-methylcarbamate;phenol |
|---|---|
| PubChem CID | 21114999 |
| Molecular Formula | C16H18ClNO3 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | (2-chloro-4,5-dimethylphenyl) N-methylcarbamate;phenol |
| SMILES | CNC(=O)Oc1cc(C)c(C)cc1Cl.Oc1ccccc1 |
| InChI | InChI=1S/C10H12ClNO2.C6H6O/c1-6-4-8(11)9(5-7(6)2)14-10(13)12-3;7-6-4-2-1-3-5-6/h4-5H,1-3H3,(H,12,13);1-5,7H |
| InChIKey | HDVXRXMXPBWPDN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |