C16H13ClN2O4 — CID 139798240
[4-(1,3-benzoxazol-2-ylmethoxy)-2-chlorophenyl] N-methylcarbamate (PubChem CID 139798240) has the molecular formula C16H13ClN2O4 and a molecular weight of 332.74 g/mol. Its IUPAC name is [4-(1,3-benzoxazol-2-ylmethoxy)-2-chlorophenyl] N-methylcarbamate.
| Compound Name | [4-(1,3-benzoxazol-2-ylmethoxy)-2-chlorophenyl] N-methylcarbamate |
|---|---|
| PubChem CID | 139798240 |
| Molecular Formula | C16H13ClN2O4 |
| Molecular Weight | 332.74 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | [4-(1,3-benzoxazol-2-ylmethoxy)-2-chlorophenyl] N-methylcarbamate |
| SMILES | CNC(=O)Oc1ccc(OCc2nc3ccccc3o2)cc1Cl |
| InChI | InChI=1S/C16H13ClN2O4/c1-18-16(20)23-13-7-6-10(8-11(13)17)21-9-15-19-12-4-2-3-5-14(12)22-15/h2-8H,9H2,1H3,(H,18,20) |
| InChIKey | UYIDCPCTEIVDHK-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.74 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |