C21H15Cl2N3O3 — CID 134466042
1-[4-(1,3-benzoxazol-2-ylmethoxy)phenyl]-3-(3,4-dichlorophenyl)urea (PubChem CID 134466042) has the molecular formula C21H15Cl2N3O3 and a molecular weight of 428.28 g/mol. Its IUPAC name is 1-[4-(1,3-benzoxazol-2-ylmethoxy)phenyl]-3-(3,4-dichlorophenyl)urea.
| Compound Name | 1-[4-(1,3-benzoxazol-2-ylmethoxy)phenyl]-3-(3,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 134466042 |
| Molecular Formula | C21H15Cl2N3O3 |
| Molecular Weight | 428.28 g/mol |
| Exact Mass | 427.05 |
| IUPAC Name | 1-[4-(1,3-benzoxazol-2-ylmethoxy)phenyl]-3-(3,4-dichlorophenyl)urea |
| SMILES | O=C(Nc1ccc(OCc2nc3ccccc3o2)cc1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H15Cl2N3O3/c22-16-10-7-14(11-17(16)23)25-21(27)24-13-5-8-15(9-6-13)28-12-20-26-18-3-1-2-4-19(18)29-20/h1-11H,12H2,(H2,24,25,27) |
| InChIKey | AOWCYAZAHRSOFB-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.28 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |