C14H12N2O2 — CID 54908622
4-(1,3-benzoxazol-2-ylmethoxy)aniline (PubChem CID 54908622) has the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. Its IUPAC name is 4-(1,3-benzoxazol-2-ylmethoxy)aniline.
| Compound Name | 4-(1,3-benzoxazol-2-ylmethoxy)aniline |
|---|---|
| PubChem CID | 54908622 |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 4-(1,3-benzoxazol-2-ylmethoxy)aniline |
| SMILES | Nc1ccc(OCc2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C14H12N2O2/c15-10-5-7-11(8-6-10)17-9-14-16-12-3-1-2-4-13(12)18-14/h1-8H,9,15H2 |
| InChIKey | RQQHLUCVKBUUDT-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|