C16H18N2O2 — CID 162737559
ethane;2-[(6-methyl-2-pyridinyl)oxymethyl]-1,3-benzoxazole (PubChem CID 162737559) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is ethane;2-[(6-methyl-2-pyridinyl)oxymethyl]-1,3-benzoxazole.
| Compound Name | ethane;2-[(6-methyl-2-pyridinyl)oxymethyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 162737559 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | ethane;2-[(6-methyl-2-pyridinyl)oxymethyl]-1,3-benzoxazole |
| SMILES | CC.Cc1cccc(OCc2nc3ccccc3o2)n1 |
| InChI | InChI=1S/C14H12N2O2.C2H6/c1-10-5-4-8-13(15-10)17-9-14-16-11-6-2-3-7-12(11)18-14;1-2/h2-8H,9H2,1H3;1-2H3 |
| InChIKey | GIWOKPXBAZGHPI-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |