C20H20N2O6 — CID 18932273
[4-(1,3-benzoxazol-2-ylmethoxy)-N-methoxycarbonyl-2-methylanilino]methyl acetate (PubChem CID 18932273) has the molecular formula C20H20N2O6 and a molecular weight of 384.39 g/mol. Its IUPAC name is [4-(1,3-benzoxazol-2-ylmethoxy)-N-methoxycarbonyl-2-methylanilino]methyl acetate.
| Compound Name | [4-(1,3-benzoxazol-2-ylmethoxy)-N-methoxycarbonyl-2-methylanilino]methyl acetate |
|---|---|
| PubChem CID | 18932273 |
| Molecular Formula | C20H20N2O6 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | [4-(1,3-benzoxazol-2-ylmethoxy)-N-methoxycarbonyl-2-methylanilino]methyl acetate |
| SMILES | COC(=O)N(COC(C)=O)c1ccc(OCc2nc3ccccc3o2)cc1C |
| InChI | InChI=1S/C20H20N2O6/c1-13-10-15(26-11-19-21-16-6-4-5-7-18(16)28-19)8-9-17(13)22(20(24)25-3)12-27-14(2)23/h4-10H,11-12H2,1-3H3 |
| InChIKey | DLCRAFSVZFRQBQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 91.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|