C16H8Cl6N2O4 — CID 3033549
(2,4,5-trichlorophenyl) N-[(E)-2-[(2,4,5-trichlorophenoxy)carbonylamino]ethenyl]carbamate (PubChem CID 3033549) has the molecular formula C16H8Cl6N2O4 and a molecular weight of 504.97 g/mol. Its IUPAC name is (2,4,5-trichlorophenyl) N-[(E)-2-[(2,4,5-trichlorophenoxy)carbonylamino]ethenyl]carbamate.
| Compound Name | (2,4,5-trichlorophenyl) N-[(E)-2-[(2,4,5-trichlorophenoxy)carbonylamino]ethenyl]carbamate |
|---|---|
| PubChem CID | 3033549 |
| Molecular Formula | C16H8Cl6N2O4 |
| Molecular Weight | 504.97 g/mol |
| Exact Mass | 501.86 |
| IUPAC Name | (2,4,5-trichlorophenyl) N-[(E)-2-[(2,4,5-trichlorophenoxy)carbonylamino]ethenyl]carbamate |
| SMILES | O=C(N/C=C/NC(=O)Oc1cc(Cl)c(Cl)cc1Cl)Oc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H8Cl6N2O4/c17-7-3-11(21)13(5-9(7)19)27-15(25)23-1-2-24-16(26)28-14-6-10(20)8(18)4-12(14)22/h1-6H,(H,23,25)(H,24,26)/b2-1+ |
| InChIKey | CEDCFCMKDWXNNH-OWOJBTEDSA-N |
| XLogP | 6.96 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.97 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|