C7H3Cl3KOS2+ — CID 54609155
potassium (2,4,5-trichlorophenoxy)methanedithioic acid (PubChem CID 54609155) has the molecular formula C7H3Cl3KOS2+ and a molecular weight of 312.69 g/mol. Its IUPAC name is potassium (2,4,5-trichlorophenoxy)methanedithioic acid.
| Compound Name | potassium (2,4,5-trichlorophenoxy)methanedithioic acid |
|---|---|
| PubChem CID | 54609155 |
| Molecular Formula | C7H3Cl3KOS2+ |
| Molecular Weight | 312.69 g/mol |
| Exact Mass | 310.83 |
| IUPAC Name | potassium (2,4,5-trichlorophenoxy)methanedithioic acid |
| SMILES | S=C(S)Oc1cc(Cl)c(Cl)cc1Cl.[K+] |
| InChI | InChI=1S/C7H3Cl3OS2.K/c8-3-1-5(10)6(2-4(3)9)11-7(12)13;/h1-2H,(H,12,13);/q;+1 |
| InChIKey | YDBVHDMEXWELSY-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.69 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|