C13H12N2O3 — CID 23118701
3-methoxynaphthalene-2,7-dicarboxamide (PubChem CID 23118701) has the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. Its IUPAC name is 3-methoxynaphthalene-2,7-dicarboxamide.
| Compound Name | 3-methoxynaphthalene-2,7-dicarboxamide |
|---|---|
| PubChem CID | 23118701 |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 3-methoxynaphthalene-2,7-dicarboxamide |
| SMILES | COc1cc2ccc(C(N)=O)cc2cc1C(N)=O |
| InChI | InChI=1S/C13H12N2O3/c1-18-11-6-7-2-3-8(12(14)16)4-9(7)5-10(11)13(15)17/h2-6H,1H3,(H2,14,16)(H2,15,17) |
| InChIKey | WYGKUFSCLOQXBK-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |