C14H16ClN2O5S+ — CID 126958846
8-methoxy-2,3,4-trimethylpyrimido[2,1-b][1,3]benzothiazol-5-ium;perchloric acid (PubChem CID 126958846) has the molecular formula C14H16ClN2O5S+ and a molecular weight of 359.81 g/mol. Its IUPAC name is 8-methoxy-2,3,4-trimethylpyrimido[2,1-b][1,3]benzothiazol-5-ium;perchloric acid.
| Compound Name | 8-methoxy-2,3,4-trimethylpyrimido[2,1-b][1,3]benzothiazol-5-ium;perchloric acid |
|---|---|
| PubChem CID | 126958846 |
| Molecular Formula | C14H16ClN2O5S+ |
| Molecular Weight | 359.81 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | 8-methoxy-2,3,4-trimethylpyrimido[2,1-b][1,3]benzothiazol-5-ium;perchloric acid |
| SMILES | COc1ccc2c(c1)sc1nc(C)c(C)c(C)[n+]12.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C14H15N2OS.ClHO4/c1-8-9(2)15-14-16(10(8)3)12-6-5-11(17-4)7-13(12)18-14;2-1(3,4)5/h5-7H,1-4H3;(H,2,3,4,5)/q+1; |
| InChIKey | GWNISFXSEGMJBB-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 115.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.81 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|