C9H10ClNO5S — CID 88819363
5-methoxy-2-methyl-1,3-benzothiazol-3-ium perchlorate (PubChem CID 88819363) has the molecular formula C9H10ClNO5S and a molecular weight of 279.70 g/mol. Its IUPAC name is 5-methoxy-2-methyl-1,3-benzothiazol-3-ium perchlorate.
| Compound Name | 5-methoxy-2-methyl-1,3-benzothiazol-3-ium perchlorate |
|---|---|
| PubChem CID | 88819363 |
| Molecular Formula | C9H10ClNO5S |
| Molecular Weight | 279.70 g/mol |
| Exact Mass | 279.00 |
| IUPAC Name | 5-methoxy-2-methyl-1,3-benzothiazol-3-ium perchlorate |
| SMILES | COc1ccc2sc(C)[nH+]c2c1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C9H9NOS.ClHO4/c1-6-10-8-5-7(11-2)3-4-9(8)12-6;2-1(3,4)5/h3-5H,1-2H3;(H,2,3,4,5) |
| InChIKey | GSLIWXWJRBEVJB-UHFFFAOYSA-N |
| XLogP | -2.72 |
| TPSA | 115.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.70 |
| LogP ≤ 5 | -2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |