C10H10O3S — CID 131098457
3,5-dimethoxy-1-benzothiophen-2-ol (PubChem CID 131098457) has the molecular formula C10H10O3S and a molecular weight of 210.25 g/mol. Its IUPAC name is 3,5-dimethoxy-1-benzothiophen-2-ol.
| Compound Name | 3,5-dimethoxy-1-benzothiophen-2-ol |
|---|---|
| PubChem CID | 131098457 |
| Molecular Formula | C10H10O3S |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | 3,5-dimethoxy-1-benzothiophen-2-ol |
| SMILES | COc1ccc2sc(O)c(OC)c2c1 |
| InChI | InChI=1S/C10H10O3S/c1-12-6-3-4-8-7(5-6)9(13-2)10(11)14-8/h3-5,11H,1-2H3 |
| InChIKey | YTOVXLNHZATCGX-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |