C11H11NO2S2 — CID 139771246
3,5-dimethoxy-1-benzothiophene-2-carbothioamide (PubChem CID 139771246) has the molecular formula C11H11NO2S2 and a molecular weight of 253.35 g/mol. Its IUPAC name is 3,5-dimethoxy-1-benzothiophene-2-carbothioamide.
| Compound Name | 3,5-dimethoxy-1-benzothiophene-2-carbothioamide |
|---|---|
| PubChem CID | 139771246 |
| Molecular Formula | C11H11NO2S2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | 3,5-dimethoxy-1-benzothiophene-2-carbothioamide |
| SMILES | COc1ccc2sc(C(N)=S)c(OC)c2c1 |
| InChI | InChI=1S/C11H11NO2S2/c1-13-6-3-4-8-7(5-6)9(14-2)10(16-8)11(12)15/h3-5H,1-2H3,(H2,12,15) |
| InChIKey | WDTMRKOGHULPGI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|