C19H26N2O3S — CID 19008807
N-[2-(cyclohexylamino)ethyl]-3,5-dimethoxy-1-benzothiophene-2-carboxamide (PubChem CID 19008807) has the molecular formula C19H26N2O3S and a molecular weight of 362.50 g/mol. Its IUPAC name is N-[2-(cyclohexylamino)ethyl]-3,5-dimethoxy-1-benzothiophene-2-carboxamide.
| Compound Name | N-[2-(cyclohexylamino)ethyl]-3,5-dimethoxy-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 19008807 |
| Molecular Formula | C19H26N2O3S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | N-[2-(cyclohexylamino)ethyl]-3,5-dimethoxy-1-benzothiophene-2-carboxamide |
| SMILES | COc1ccc2sc(C(=O)NCCNC3CCCCC3)c(OC)c2c1 |
| InChI | InChI=1S/C19H26N2O3S/c1-23-14-8-9-16-15(12-14)17(24-2)18(25-16)19(22)21-11-10-20-13-6-4-3-5-7-13/h8-9,12-13,20H,3-7,10-11H2,1-2H3,(H,21,22) |
| InChIKey | GDNFDZRGTBAAMY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|