C18H23N4S+ — CID 159160434
4-[(3,6-dimethyl-1,3-benzothiazol-3-ium-2-yl)diazenyl]-N,N-dimethylaniline;methane (PubChem CID 159160434) has the molecular formula C18H23N4S+ and a molecular weight of 327.48 g/mol. Its IUPAC name is 4-[(3,6-dimethyl-1,3-benzothiazol-3-ium-2-yl)diazenyl]-N,N-dimethylaniline;methane.
| Compound Name | 4-[(3,6-dimethyl-1,3-benzothiazol-3-ium-2-yl)diazenyl]-N,N-dimethylaniline;methane |
|---|---|
| PubChem CID | 159160434 |
| Molecular Formula | C18H23N4S+ |
| Molecular Weight | 327.48 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 4-[(3,6-dimethyl-1,3-benzothiazol-3-ium-2-yl)diazenyl]-N,N-dimethylaniline;methane |
| SMILES | C.Cc1ccc2c(c1)sc(/N=N/c1ccc(N(C)C)cc1)[n+]2C |
| InChI | InChI=1S/C17H19N4S.CH4/c1-12-5-10-15-16(11-12)22-17(21(15)4)19-18-13-6-8-14(9-7-13)20(2)3;/h5-11H,1-4H3;1H4/q+1; |
| InChIKey | KKKNACABIULYKA-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 31.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.48 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|