C14H16N4 — CID 87314088
N,N-dimethyl-4-[(5-methyl-2-pyridinyl)diazenyl]aniline (PubChem CID 87314088) has the molecular formula C14H16N4 and a molecular weight of 240.31 g/mol. Its IUPAC name is N,N-dimethyl-4-[(5-methyl-2-pyridinyl)diazenyl]aniline.
| Compound Name | N,N-dimethyl-4-[(5-methyl-2-pyridinyl)diazenyl]aniline |
|---|---|
| PubChem CID | 87314088 |
| Molecular Formula | C14H16N4 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | N,N-dimethyl-4-[(5-methyl-2-pyridinyl)diazenyl]aniline |
| SMILES | Cc1ccc(/N=N/c2ccc(N(C)C)cc2)nc1 |
| InChI | InChI=1S/C14H16N4/c1-11-4-9-14(15-10-11)17-16-12-5-7-13(8-6-12)18(2)3/h4-10H,1-3H3/b17-16+ |
| InChIKey | GAOFJYVCCLMVLK-WUKNDPDISA-N |
| XLogP | 3.87 |
| TPSA | 40.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|