C14H13F2N3 — CID 9592
4-[(3,5-difluorophenyl)diazenyl]-N,N-dimethylaniline (PubChem CID 9592) has the molecular formula C14H13F2N3 and a molecular weight of 261.27 g/mol. Its IUPAC name is 4-[(3,5-difluorophenyl)diazenyl]-N,N-dimethylaniline.
| Compound Name | 4-[(3,5-difluorophenyl)diazenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 9592 |
| Molecular Formula | C14H13F2N3 |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 4-[(3,5-difluorophenyl)diazenyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/N=N/c2cc(F)cc(F)c2)cc1 |
| InChI | InChI=1S/C14H13F2N3/c1-19(2)14-5-3-12(4-6-14)17-18-13-8-10(15)7-11(16)9-13/h3-9H,1-2H3/b18-17+ |
| InChIKey | CJBNNIWJXFBNMZ-ISLYRVAYSA-N |
| XLogP | 4.45 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|