C16H21N3O2Si — CID 159881311
4-[(4-dimethoxysilylphenyl)diazenyl]-N,N-dimethylaniline (PubChem CID 159881311) has the molecular formula C16H21N3O2Si and a molecular weight of 315.45 g/mol. Its IUPAC name is 4-[(4-dimethoxysilylphenyl)diazenyl]-N,N-dimethylaniline.
| Compound Name | 4-[(4-dimethoxysilylphenyl)diazenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 159881311 |
| Molecular Formula | C16H21N3O2Si |
| Molecular Weight | 315.45 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 4-[(4-dimethoxysilylphenyl)diazenyl]-N,N-dimethylaniline |
| SMILES | CO[SiH](OC)c1ccc(/N=N/c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C16H21N3O2Si/c1-19(2)15-9-5-13(6-10-15)17-18-14-7-11-16(12-8-14)22(20-3)21-4/h5-12,22H,1-4H3/b18-17+ |
| InChIKey | NMZKEDBBOAMSLH-ISLYRVAYSA-N |
| XLogP | 2.89 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.45 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|