C17H19N2S2+ — CID 58659886
N,N-dimethyl-4-(3-methyl-6-methylsulfanyl-1,3-benzothiazol-3-ium-2-yl)aniline (PubChem CID 58659886) has the molecular formula C17H19N2S2+ and a molecular weight of 315.49 g/mol. Its IUPAC name is N,N-dimethyl-4-(3-methyl-6-methylsulfanyl-1,3-benzothiazol-3-ium-2-yl)aniline.
| Compound Name | N,N-dimethyl-4-(3-methyl-6-methylsulfanyl-1,3-benzothiazol-3-ium-2-yl)aniline |
|---|---|
| PubChem CID | 58659886 |
| Molecular Formula | C17H19N2S2+ |
| Molecular Weight | 315.49 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | N,N-dimethyl-4-(3-methyl-6-methylsulfanyl-1,3-benzothiazol-3-ium-2-yl)aniline |
| SMILES | CSc1ccc2c(c1)sc(-c1ccc(N(C)C)cc1)[n+]2C |
| InChI | InChI=1S/C17H19N2S2/c1-18(2)13-7-5-12(6-8-13)17-19(3)15-10-9-14(20-4)11-16(15)21-17/h5-11H,1-4H3/q+1 |
| InChIKey | ASIOVJRLQJNKBG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.49 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|